C14H18 — CID 10511779
(1'S,7'R)-spiro[cyclopentane-1,10'-tricyclo[5.2.1.02,6]deca-2(6),8-diene] (PubChem CID 10511779) has the molecular formula C14H18 and a molecular weight of 186.30 g/mol. Its IUPAC name is (1'S,7'R)-spiro[cyclopentane-1,10'-tricyclo[5.2.1.02,6]deca-2(6),8-diene].
| Compound Name | (1'S,7'R)-spiro[cyclopentane-1,10'-tricyclo[5.2.1.02,6]deca-2(6),8-diene] |
|---|---|
| PubChem CID | 10511779 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | (1'S,7'R)-spiro[cyclopentane-1,10'-tricyclo[5.2.1.02,6]deca-2(6),8-diene] |
| SMILES | C1=C[C@H]2C3=C(CCC3)[C@@H]1C21CCCC1 |
| InChI | InChI=1S/C14H18/c1-2-9-14(8-1)12-6-7-13(14)11-5-3-4-10(11)12/h6-7,12-13H,1-5,8-9H2/t12-,13+ |
| InChIKey | UKWXDDWELKMCPV-BETUJISGSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|