C19H24 — CID 95564238
(1'S,8'R)-3',4',5',6'-tetramethylspiro[cyclopentane-1,11'-tricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene] (PubChem CID 95564238) has the molecular formula C19H24 and a molecular weight of 252.40 g/mol. Its IUPAC name is (1'S,8'R)-3',4',5',6'-tetramethylspiro[cyclopentane-1,11'-tricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene].
| Compound Name | (1'S,8'R)-3',4',5',6'-tetramethylspiro[cyclopentane-1,11'-tricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene] |
|---|---|
| PubChem CID | 95564238 |
| Molecular Formula | C19H24 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | (1'S,8'R)-3',4',5',6'-tetramethylspiro[cyclopentane-1,11'-tricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene] |
| SMILES | Cc1c(C)c(C)c2c(c1C)[C@H]1C=C[C@@H]2C12CCCC2 |
| InChI | InChI=1S/C19H24/c1-11-12(2)14(4)18-16-8-7-15(17(18)13(11)3)19(16)9-5-6-10-19/h7-8,15-16H,5-6,9-10H2,1-4H3/t15-,16+ |
| InChIKey | AOAMPTWZZPMAGW-IYBDPMFKSA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|