C17H22 — CID 102217747
1,1-di(cyclopenta-2,4-dien-1-yl)cycloheptane (PubChem CID 102217747) has the molecular formula C17H22 and a molecular weight of 226.36 g/mol. Its IUPAC name is 1,1-di(cyclopenta-2,4-dien-1-yl)cycloheptane.
| Compound Name | 1,1-di(cyclopenta-2,4-dien-1-yl)cycloheptane |
|---|---|
| PubChem CID | 102217747 |
| Molecular Formula | C17H22 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 1,1-di(cyclopenta-2,4-dien-1-yl)cycloheptane |
| SMILES | C1=CC(C2(C3C=CC=C3)CCCCCC2)C=C1 |
| InChI | InChI=1S/C17H22/c1-2-8-14-17(13-7-1,15-9-3-4-10-15)16-11-5-6-12-16/h3-6,9-12,15-16H,1-2,7-8,13-14H2 |
| InChIKey | WWARJTXDKUNONJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |