C9H6F3N3S — CID 105146431
thiadiazol-4-yl-(2,3,4-trifluorophenyl)methanamine (PubChem CID 105146431) has the molecular formula C9H6F3N3S and a molecular weight of 245.23 g/mol. Its IUPAC name is thiadiazol-4-yl-(2,3,4-trifluorophenyl)methanamine.
| Compound Name | thiadiazol-4-yl-(2,3,4-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 105146431 |
| Molecular Formula | C9H6F3N3S |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.02 |
| IUPAC Name | thiadiazol-4-yl-(2,3,4-trifluorophenyl)methanamine |
| SMILES | NC(c1csnn1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C9H6F3N3S/c10-5-2-1-4(7(11)8(5)12)9(13)6-3-16-15-14-6/h1-3,9H,13H2 |
| InChIKey | LSVIMLATHCOYNI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|