C14H28O2Si — CID 10515261
1-[(1R,3R)-3-[methoxy(dimethyl)silyl]cyclopentyl]-3,3-dimethylbutan-1-one (PubChem CID 10515261) has the molecular formula C14H28O2Si and a molecular weight of 256.46 g/mol. Its IUPAC name is 1-[(1R,3R)-3-[methoxy(dimethyl)silyl]cyclopentyl]-3,3-dimethylbutan-1-one.
| Compound Name | 1-[(1R,3R)-3-[methoxy(dimethyl)silyl]cyclopentyl]-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 10515261 |
| Molecular Formula | C14H28O2Si |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 1-[(1R,3R)-3-[methoxy(dimethyl)silyl]cyclopentyl]-3,3-dimethylbutan-1-one |
| SMILES | CO[Si](C)(C)[C@@H]1CC[C@@H](C(=O)CC(C)(C)C)C1 |
| InChI | InChI=1S/C14H28O2Si/c1-14(2,3)10-13(15)11-7-8-12(9-11)17(5,6)16-4/h11-12H,7-10H2,1-6H3/t11-,12-/m1/s1 |
| InChIKey | NTJRXGMQQJWDIX-VXGBXAGGSA-N |
| XLogP | 4.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|