C13H25NO2S — CID 105153184
1-(1,1-dioxothiolan-3-yl)-N-ethylhept-6-en-2-amine (PubChem CID 105153184) has the molecular formula C13H25NO2S and a molecular weight of 259.41 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-N-ethylhept-6-en-2-amine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-N-ethylhept-6-en-2-amine |
|---|---|
| PubChem CID | 105153184 |
| Molecular Formula | C13H25NO2S |
| Molecular Weight | 259.41 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-N-ethylhept-6-en-2-amine |
| SMILES | C=CCCCC(CC1CCS(=O)(=O)C1)NCC |
| InChI | InChI=1S/C13H25NO2S/c1-3-5-6-7-13(14-4-2)10-12-8-9-17(15,16)11-12/h3,12-14H,1,4-11H2,2H3 |
| InChIKey | SBDPPBADZBRSFU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|