C15H31NO2S — CID 55211720
2-(1,1-dioxothiolan-3-yl)-N-propan-2-yloctan-1-amine (PubChem CID 55211720) has the molecular formula C15H31NO2S and a molecular weight of 289.48 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-N-propan-2-yloctan-1-amine.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-N-propan-2-yloctan-1-amine |
|---|---|
| PubChem CID | 55211720 |
| Molecular Formula | C15H31NO2S |
| Molecular Weight | 289.48 g/mol |
| Exact Mass | 289.21 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-N-propan-2-yloctan-1-amine |
| SMILES | CCCCCCC(CNC(C)C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H31NO2S/c1-4-5-6-7-8-14(11-16-13(2)3)15-9-10-19(17,18)12-15/h13-16H,4-12H2,1-3H3 |
| InChIKey | GNRYMDUMOCJCJS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.48 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|