C16H28N2O — CID 10515784
(2R,7R,9R)-7-pentyl-1,6-diazatricyclo[7.4.0.02,6]tridecan-5-one (PubChem CID 10515784) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is (2R,7R,9R)-7-pentyl-1,6-diazatricyclo[7.4.0.02,6]tridecan-5-one.
| Compound Name | (2R,7R,9R)-7-pentyl-1,6-diazatricyclo[7.4.0.02,6]tridecan-5-one |
|---|---|
| PubChem CID | 10515784 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | (2R,7R,9R)-7-pentyl-1,6-diazatricyclo[7.4.0.02,6]tridecan-5-one |
| SMILES | CCCCC[C@@H]1C[C@H]2CCCCN2[C@H]2CCC(=O)N12 |
| InChI | InChI=1S/C16H28N2O/c1-2-3-4-8-14-12-13-7-5-6-11-17(13)15-9-10-16(19)18(14)15/h13-15H,2-12H2,1H3/t13-,14-,15-/m1/s1 |
| InChIKey | QOMPQKWTEMBHKD-RBSFLKMASA-N |
| XLogP | 3.14 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|