C13H18O7 — CID 10517299
(4-hydroxy-5-oxooxolan-3-yl)methyl (2E,6E)-4,5-dihydroxyocta-2,6-dienoate (PubChem CID 10517299) has the molecular formula C13H18O7 and a molecular weight of 286.28 g/mol. Its IUPAC name is (4-hydroxy-5-oxooxolan-3-yl)methyl (2E,6E)-4,5-dihydroxyocta-2,6-dienoate.
| Compound Name | (4-hydroxy-5-oxooxolan-3-yl)methyl (2E,6E)-4,5-dihydroxyocta-2,6-dienoate |
|---|---|
| PubChem CID | 10517299 |
| Molecular Formula | C13H18O7 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | (4-hydroxy-5-oxooxolan-3-yl)methyl (2E,6E)-4,5-dihydroxyocta-2,6-dienoate |
| SMILES | C/C=C/C(O)C(O)/C=C/C(=O)OCC1COC(=O)C1O |
| InChI | InChI=1S/C13H18O7/c1-2-3-9(14)10(15)4-5-11(16)19-6-8-7-20-13(18)12(8)17/h2-5,8-10,12,14-15,17H,6-7H2,1H3/b3-2+,5-4+ |
| InChIKey | JHQCSIROSIRYBV-MQQKCMAXSA-N |
| XLogP | -1.08 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|