C11H10FNO3S2 — CID 10517388
5-[(3-fluorophenyl)-hydroxymethyl]thiophene-3-sulfonamide (PubChem CID 10517388) has the molecular formula C11H10FNO3S2 and a molecular weight of 287.34 g/mol. Its IUPAC name is 5-[(3-fluorophenyl)-hydroxymethyl]thiophene-3-sulfonamide.
| Compound Name | 5-[(3-fluorophenyl)-hydroxymethyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 10517388 |
| Molecular Formula | C11H10FNO3S2 |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 5-[(3-fluorophenyl)-hydroxymethyl]thiophene-3-sulfonamide |
| SMILES | NS(=O)(=O)c1csc(C(O)c2cccc(F)c2)c1 |
| InChI | InChI=1S/C11H10FNO3S2/c12-8-3-1-2-7(4-8)11(14)10-5-9(6-17-10)18(13,15)16/h1-6,11,14H,(H2,13,15,16) |
| InChIKey | CGGWFDHGPBVLLM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |