C12H13NO4S2 — CID 10518258
5-[hydroxy-[4-(hydroxymethyl)phenyl]methyl]thiophene-3-sulfonamide (PubChem CID 10518258) has the molecular formula C12H13NO4S2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 5-[hydroxy-[4-(hydroxymethyl)phenyl]methyl]thiophene-3-sulfonamide.
| Compound Name | 5-[hydroxy-[4-(hydroxymethyl)phenyl]methyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 10518258 |
| Molecular Formula | C12H13NO4S2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 5-[hydroxy-[4-(hydroxymethyl)phenyl]methyl]thiophene-3-sulfonamide |
| SMILES | NS(=O)(=O)c1csc(C(O)c2ccc(CO)cc2)c1 |
| InChI | InChI=1S/C12H13NO4S2/c13-19(16,17)10-5-11(18-7-10)12(15)9-3-1-8(6-14)2-4-9/h1-5,7,12,14-15H,6H2,(H2,13,16,17) |
| InChIKey | NWWGGZYOUQDUTH-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |