C11H11NO4S2 — CID 10708264
5-[hydroxy-(4-hydroxyphenyl)methyl]thiophene-3-sulfonamide (PubChem CID 10708264) has the molecular formula C11H11NO4S2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 5-[hydroxy-(4-hydroxyphenyl)methyl]thiophene-3-sulfonamide.
| Compound Name | 5-[hydroxy-(4-hydroxyphenyl)methyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 10708264 |
| Molecular Formula | C11H11NO4S2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | 5-[hydroxy-(4-hydroxyphenyl)methyl]thiophene-3-sulfonamide |
| SMILES | NS(=O)(=O)c1csc(C(O)c2ccc(O)cc2)c1 |
| InChI | InChI=1S/C11H11NO4S2/c12-18(15,16)9-5-10(17-6-9)11(14)7-1-3-8(13)4-2-7/h1-6,11,13-14H,(H2,12,15,16) |
| InChIKey | NXQVRXDFOHZZTA-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |