C18H24O3 — CID 10517472
propan-2-yl (1R,2R,4R)-1-hydroxy-4-phenyl-2-prop-1-en-2-ylcyclopentane-1-carboxylate (PubChem CID 10517472) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is propan-2-yl (1R,2R,4R)-1-hydroxy-4-phenyl-2-prop-1-en-2-ylcyclopentane-1-carboxylate.
| Compound Name | propan-2-yl (1R,2R,4R)-1-hydroxy-4-phenyl-2-prop-1-en-2-ylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 10517472 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | propan-2-yl (1R,2R,4R)-1-hydroxy-4-phenyl-2-prop-1-en-2-ylcyclopentane-1-carboxylate |
| SMILES | C=C(C)[C@H]1C[C@@H](c2ccccc2)C[C@]1(O)C(=O)OC(C)C |
| InChI | InChI=1S/C18H24O3/c1-12(2)16-10-15(14-8-6-5-7-9-14)11-18(16,20)17(19)21-13(3)4/h5-9,13,15-16,20H,1,10-11H2,2-4H3/t15-,16-,18-/m1/s1 |
| InChIKey | TUQCNJDTCMPEQX-JFIYKMOQSA-N |
| XLogP | 3.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|