C27H30O5 — CID 53235986
dipropan-2-yl (1R,2S,3R,4R)-1-hydroxy-3-phenyl-4-(2-phenylethynyl)cyclopentane-1,2-dicarboxylate (PubChem CID 53235986) has the molecular formula C27H30O5 and a molecular weight of 434.53 g/mol. Its IUPAC name is dipropan-2-yl (1R,2S,3R,4R)-1-hydroxy-3-phenyl-4-(2-phenylethynyl)cyclopentane-1,2-dicarboxylate.
| Compound Name | dipropan-2-yl (1R,2S,3R,4R)-1-hydroxy-3-phenyl-4-(2-phenylethynyl)cyclopentane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 53235986 |
| Molecular Formula | C27H30O5 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | dipropan-2-yl (1R,2S,3R,4R)-1-hydroxy-3-phenyl-4-(2-phenylethynyl)cyclopentane-1,2-dicarboxylate |
| SMILES | CC(C)OC(=O)[C@H]1[C@H](c2ccccc2)[C@H](C#Cc2ccccc2)C[C@]1(O)C(=O)OC(C)C |
| InChI | InChI=1S/C27H30O5/c1-18(2)31-25(28)24-23(21-13-9-6-10-14-21)22(16-15-20-11-7-5-8-12-20)17-27(24,30)26(29)32-19(3)4/h5-14,18-19,22-24,30H,17H2,1-4H3/t22-,23-,24-,27-/m1/s1 |
| InChIKey | TXQSIDIWZGBMRA-ANNHOSHMSA-N |
| XLogP | 4.09 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|