C12H15N3O3S2 — CID 10519267
ethyl 7-[(E)-methoxyiminomethyl]-6-methyl-2-methylsulfanylpyrazolo[5,1-b][1,3]thiazole-3-carboxylate (PubChem CID 10519267) has the molecular formula C12H15N3O3S2 and a molecular weight of 313.40 g/mol. Its IUPAC name is ethyl 7-[(E)-methoxyiminomethyl]-6-methyl-2-methylsulfanylpyrazolo[5,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | ethyl 7-[(E)-methoxyiminomethyl]-6-methyl-2-methylsulfanylpyrazolo[5,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 10519267 |
| Molecular Formula | C12H15N3O3S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | ethyl 7-[(E)-methoxyiminomethyl]-6-methyl-2-methylsulfanylpyrazolo[5,1-b][1,3]thiazole-3-carboxylate |
| SMILES | CCOC(=O)c1c(SC)sc2c(/C=N/OC)c(C)nn12 |
| InChI | InChI=1S/C12H15N3O3S2/c1-5-18-11(16)9-12(19-4)20-10-8(6-13-17-3)7(2)14-15(9)10/h6H,5H2,1-4H3/b13-6+ |
| InChIKey | GMNKVWLHTMFLLU-AWNIVKPZSA-N |
| XLogP | 2.58 |
| TPSA | 65.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|