C18H20F3N3O3 — CID 54145058
ethyl 1,3-dimethyl-4-[1-[3-(trifluoromethyl)phenyl]ethoxyiminomethyl]pyrazole-5-carboxylate (PubChem CID 54145058) has the molecular formula C18H20F3N3O3 and a molecular weight of 383.37 g/mol. Its IUPAC name is ethyl 1,3-dimethyl-4-[1-[3-(trifluoromethyl)phenyl]ethoxyiminomethyl]pyrazole-5-carboxylate.
| Compound Name | ethyl 1,3-dimethyl-4-[1-[3-(trifluoromethyl)phenyl]ethoxyiminomethyl]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 54145058 |
| Molecular Formula | C18H20F3N3O3 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | ethyl 1,3-dimethyl-4-[1-[3-(trifluoromethyl)phenyl]ethoxyiminomethyl]pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1c(C=NOC(C)c2cccc(C(F)(F)F)c2)c(C)nn1C |
| InChI | InChI=1S/C18H20F3N3O3/c1-5-26-17(25)16-15(11(2)23-24(16)4)10-22-27-12(3)13-7-6-8-14(9-13)18(19,20)21/h6-10,12H,5H2,1-4H3 |
| InChIKey | ODTVJTYHXLEFKL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|