C16H34O4Si — CID 10519630
(3R,4R,5S)-6-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-3,5-dimethylhexanal (PubChem CID 10519630) has the molecular formula C16H34O4Si and a molecular weight of 318.53 g/mol. Its IUPAC name is (3R,4R,5S)-6-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-3,5-dimethylhexanal.
| Compound Name | (3R,4R,5S)-6-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-3,5-dimethylhexanal |
|---|---|
| PubChem CID | 10519630 |
| Molecular Formula | C16H34O4Si |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (3R,4R,5S)-6-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-3,5-dimethylhexanal |
| SMILES | COCO[C@H]([C@H](C)CC=O)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H34O4Si/c1-13(9-10-17)15(19-12-18-6)14(2)11-20-21(7,8)16(3,4)5/h10,13-15H,9,11-12H2,1-8H3/t13-,14+,15-/m1/s1 |
| InChIKey | ZJZIRQCKWSFIAK-QLFBSQMISA-N |
| XLogP | 3.86 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|