C19H38O4Si — CID 11078855
[(2R,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-6-oxohexyl] 2,2-dimethylpropanoate (PubChem CID 11078855) has the molecular formula C19H38O4Si and a molecular weight of 358.60 g/mol. Its IUPAC name is [(2R,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-6-oxohexyl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-6-oxohexyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11078855 |
| Molecular Formula | C19H38O4Si |
| Molecular Weight | 358.60 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | [(2R,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-6-oxohexyl] 2,2-dimethylpropanoate |
| SMILES | C[C@H](COC(=O)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CC=O |
| InChI | InChI=1S/C19H38O4Si/c1-14(11-12-20)16(23-24(9,10)19(6,7)8)15(2)13-22-17(21)18(3,4)5/h12,14-16H,11,13H2,1-10H3/t14-,15+,16-/m0/s1 |
| InChIKey | GLMCQZDDCHEYAB-XHSDSOJGSA-N |
| XLogP | 4.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.60 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|