C16H18N2O6S — CID 10522908
[(1R,2S,3R,4R)-4-(2,4-dioxo-5-thiophen-2-ylpyrimidin-1-yl)-2,3-dihydroxycyclopentyl]methyl acetate (PubChem CID 10522908) has the molecular formula C16H18N2O6S and a molecular weight of 366.40 g/mol. Its IUPAC name is [(1R,2S,3R,4R)-4-(2,4-dioxo-5-thiophen-2-ylpyrimidin-1-yl)-2,3-dihydroxycyclopentyl]methyl acetate.
| Compound Name | [(1R,2S,3R,4R)-4-(2,4-dioxo-5-thiophen-2-ylpyrimidin-1-yl)-2,3-dihydroxycyclopentyl]methyl acetate |
|---|---|
| PubChem CID | 10522908 |
| Molecular Formula | C16H18N2O6S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | [(1R,2S,3R,4R)-4-(2,4-dioxo-5-thiophen-2-ylpyrimidin-1-yl)-2,3-dihydroxycyclopentyl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1C[C@@H](n2cc(-c3cccs3)c(=O)[nH]c2=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H18N2O6S/c1-8(19)24-7-9-5-11(14(21)13(9)20)18-6-10(12-3-2-4-25-12)15(22)17-16(18)23/h2-4,6,9,11,13-14,20-21H,5,7H2,1H3,(H,17,22,23)/t9-,11-,13+,14-/m1/s1 |
| InChIKey | HPUPWKXAXMVDCB-QIRAZROLSA-N |
| XLogP | 0.11 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |