C16H18N2O7 — CID 10760291
[(1R,2R,3S,4R)-4-[5-(furan-2-yl)-2,4-dioxopyrimidin-1-yl]-2,3-dihydroxycyclopentyl]methyl acetate (PubChem CID 10760291) has the molecular formula C16H18N2O7 and a molecular weight of 350.33 g/mol. Its IUPAC name is [(1R,2R,3S,4R)-4-[5-(furan-2-yl)-2,4-dioxopyrimidin-1-yl]-2,3-dihydroxycyclopentyl]methyl acetate.
| Compound Name | [(1R,2R,3S,4R)-4-[5-(furan-2-yl)-2,4-dioxopyrimidin-1-yl]-2,3-dihydroxycyclopentyl]methyl acetate |
|---|---|
| PubChem CID | 10760291 |
| Molecular Formula | C16H18N2O7 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | [(1R,2R,3S,4R)-4-[5-(furan-2-yl)-2,4-dioxopyrimidin-1-yl]-2,3-dihydroxycyclopentyl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1C[C@@H](n2cc(-c3ccco3)c(=O)[nH]c2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H18N2O7/c1-8(19)25-7-9-5-11(14(21)13(9)20)18-6-10(12-3-2-4-24-12)15(22)17-16(18)23/h2-4,6,9,11,13-14,20-21H,5,7H2,1H3,(H,17,22,23)/t9-,11-,13-,14+/m1/s1 |
| InChIKey | LBRAFYHVPWRBEI-IMJCEVDSSA-N |
| XLogP | -0.36 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |