C13H14N2O4S — CID 11358342
1-[(E)-4,5-dihydroxypent-2-enyl]-5-thiophen-2-ylpyrimidine-2,4-dione (PubChem CID 11358342) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is 1-[(E)-4,5-dihydroxypent-2-enyl]-5-thiophen-2-ylpyrimidine-2,4-dione.
| Compound Name | 1-[(E)-4,5-dihydroxypent-2-enyl]-5-thiophen-2-ylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11358342 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 1-[(E)-4,5-dihydroxypent-2-enyl]-5-thiophen-2-ylpyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(C/C=C/C(O)CO)cc1-c1cccs1 |
| InChI | InChI=1S/C13H14N2O4S/c16-8-9(17)3-1-5-15-7-10(11-4-2-6-20-11)12(18)14-13(15)19/h1-4,6-7,9,16-17H,5,8H2,(H,14,18,19)/b3-1+ |
| InChIKey | IKKLOCMFVMEEFV-HNQUOIGGSA-N |
| XLogP | 0.17 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|