C17H21F3N2O2 — CID 10523732
1-(dicyclopropylmethylideneamino)oxy-3-[4-(trifluoromethyl)anilino]propan-2-ol (PubChem CID 10523732) has the molecular formula C17H21F3N2O2 and a molecular weight of 342.36 g/mol. Its IUPAC name is 1-(dicyclopropylmethylideneamino)oxy-3-[4-(trifluoromethyl)anilino]propan-2-ol.
| Compound Name | 1-(dicyclopropylmethylideneamino)oxy-3-[4-(trifluoromethyl)anilino]propan-2-ol |
|---|---|
| PubChem CID | 10523732 |
| Molecular Formula | C17H21F3N2O2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 1-(dicyclopropylmethylideneamino)oxy-3-[4-(trifluoromethyl)anilino]propan-2-ol |
| SMILES | OC(CNc1ccc(C(F)(F)F)cc1)CON=C(C1CC1)C1CC1 |
| InChI | InChI=1S/C17H21F3N2O2/c18-17(19,20)13-5-7-14(8-6-13)21-9-15(23)10-24-22-16(11-1-2-11)12-3-4-12/h5-8,11-12,15,21,23H,1-4,9-10H2 |
| InChIKey | ATQWRWLPKWOPMP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|