C11H22F3N3 — CID 105242271
N,N-dimethyl-1-(4,4,4-trifluoro-1-hydrazinylbutyl)cyclopentan-1-amine (PubChem CID 105242271) has the molecular formula C11H22F3N3 and a molecular weight of 253.31 g/mol. Its IUPAC name is N,N-dimethyl-1-(4,4,4-trifluoro-1-hydrazinylbutyl)cyclopentan-1-amine.
| Compound Name | N,N-dimethyl-1-(4,4,4-trifluoro-1-hydrazinylbutyl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 105242271 |
| Molecular Formula | C11H22F3N3 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | N,N-dimethyl-1-(4,4,4-trifluoro-1-hydrazinylbutyl)cyclopentan-1-amine |
| SMILES | CN(C)C1(C(CCC(F)(F)F)NN)CCCC1 |
| InChI | InChI=1S/C11H22F3N3/c1-17(2)10(6-3-4-7-10)9(16-15)5-8-11(12,13)14/h9,16H,3-8,15H2,1-2H3 |
| InChIKey | FMDXHSBRHRUGQV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|