C19H22N6O5 — CID 10525833
2-[[(2S,5R)-5-(5-amino-7-methyl-2,6,7,9,11-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,8,10-pentaen-2-yl)-2,5-dihydrofuran-2-yl]methoxy]-2,5,5-trimethyl-1,3-dioxolan-4-one (PubChem CID 10525833) has the molecular formula C19H22N6O5 and a molecular weight of 414.42 g/mol. Its IUPAC name is 2-[[(2S,5R)-5-(5-amino-7-methyl-2,6,7,9,11-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,8,10-pentaen-2-yl)-2,5-dihydrofuran-2-yl]methoxy]-2,5,5-trimethyl-1,3-dioxolan-4-one.
| Compound Name | 2-[[(2S,5R)-5-(5-amino-7-methyl-2,6,7,9,11-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,8,10-pentaen-2-yl)-2,5-dihydrofuran-2-yl]methoxy]-2,5,5-trimethyl-1,3-dioxolan-4-one |
|---|---|
| PubChem CID | 10525833 |
| Molecular Formula | C19H22N6O5 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 2-[[(2S,5R)-5-(5-amino-7-methyl-2,6,7,9,11-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,8,10-pentaen-2-yl)-2,5-dihydrofuran-2-yl]methoxy]-2,5,5-trimethyl-1,3-dioxolan-4-one |
| SMILES | CN1N=C(N)c2cn([C@H]3C=C[C@@H](COC4(C)OC(=O)C(C)(C)O4)O3)c3ncnc1c23 |
| InChI | InChI=1S/C19H22N6O5/c1-18(2)17(26)29-19(3,30-18)27-8-10-5-6-12(28-10)25-7-11-13-15(21-9-22-16(13)25)24(4)23-14(11)20/h5-7,9-10,12H,8H2,1-4H3,(H2,20,23)/t10-,12+,19?/m0/s1 |
| InChIKey | HLXHGTZAUMQEQS-WIYWQTCKSA-N |
| XLogP | 1.00 |
| TPSA | 126.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|