C21H24N6O8 — CID 10719787
[(2R,3R,4R,5R)-5-(5-acetamido-7-methyl-2,6,7,9,11-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,8,10-pentaen-2-yl)-3,4-diacetyloxyoxolan-2-yl]methyl acetate (PubChem CID 10719787) has the molecular formula C21H24N6O8 and a molecular weight of 488.46 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(5-acetamido-7-methyl-2,6,7,9,11-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,8,10-pentaen-2-yl)-3,4-diacetyloxyoxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-5-(5-acetamido-7-methyl-2,6,7,9,11-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,8,10-pentaen-2-yl)-3,4-diacetyloxyoxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10719787 |
| Molecular Formula | C21H24N6O8 |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(5-acetamido-7-methyl-2,6,7,9,11-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,8,10-pentaen-2-yl)-3,4-diacetyloxyoxolan-2-yl]methyl acetate |
| SMILES | CC(=O)NC1=NN(C)c2ncnc3c2c1cn3[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H24N6O8/c1-9(28)24-18-13-6-27(20-15(13)19(22-8-23-20)26(5)25-18)21-17(34-12(4)31)16(33-11(3)30)14(35-21)7-32-10(2)29/h6,8,14,16-17,21H,7H2,1-5H3,(H,24,25,28)/t14-,16-,17-,21-/m1/s1 |
| InChIKey | REZPOSYFOFGZTN-VGKBRBPRSA-N |
| XLogP | 0.00 |
| TPSA | 163.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|