C23H28N6O8 — CID 10673420
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[5-(butanoylamino)-7-methyl-2,6,7,9,11-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,8,10-pentaen-2-yl]oxolan-2-yl]methyl acetate (PubChem CID 10673420) has the molecular formula C23H28N6O8 and a molecular weight of 516.51 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[5-(butanoylamino)-7-methyl-2,6,7,9,11-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,8,10-pentaen-2-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[5-(butanoylamino)-7-methyl-2,6,7,9,11-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,8,10-pentaen-2-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10673420 |
| Molecular Formula | C23H28N6O8 |
| Molecular Weight | 516.51 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[5-(butanoylamino)-7-methyl-2,6,7,9,11-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,8,10-pentaen-2-yl]oxolan-2-yl]methyl acetate |
| SMILES | CCCC(=O)NC1=NN(C)c2ncnc3c2c1cn3[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C23H28N6O8/c1-6-7-16(33)26-20-14-8-29(22-17(14)21(24-10-25-22)28(5)27-20)23-19(36-13(4)32)18(35-12(3)31)15(37-23)9-34-11(2)30/h8,10,15,18-19,23H,6-7,9H2,1-5H3,(H,26,27,33)/t15-,18-,19-,23-/m1/s1 |
| InChIKey | WRVVVJBHAKHVGL-VZKMNXCRSA-N |
| XLogP | 0.78 |
| TPSA | 163.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.51 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|