C19H23BrN4O7S — CID 67463726
[(2R,3R,4S,5R)-4-bromo-5-(6-methylsulfanylpurin-9-yl)-2-[(2,4,4-trimethyl-5-oxo-1,3-dioxolan-2-yl)oxymethyl]oxolan-3-yl] acetate (PubChem CID 67463726) has the molecular formula C19H23BrN4O7S and a molecular weight of 531.39 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-4-bromo-5-(6-methylsulfanylpurin-9-yl)-2-[(2,4,4-trimethyl-5-oxo-1,3-dioxolan-2-yl)oxymethyl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R)-4-bromo-5-(6-methylsulfanylpurin-9-yl)-2-[(2,4,4-trimethyl-5-oxo-1,3-dioxolan-2-yl)oxymethyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 67463726 |
| Molecular Formula | C19H23BrN4O7S |
| Molecular Weight | 531.39 g/mol |
| Exact Mass | 530.05 |
| IUPAC Name | [(2R,3R,4S,5R)-4-bromo-5-(6-methylsulfanylpurin-9-yl)-2-[(2,4,4-trimethyl-5-oxo-1,3-dioxolan-2-yl)oxymethyl]oxolan-3-yl] acetate |
| SMILES | CSc1ncnc2c1ncn2[C@@H]1O[C@H](COC2(C)OC(=O)C(C)(C)O2)[C@@H](OC(C)=O)[C@@H]1Br |
| InChI | InChI=1S/C19H23BrN4O7S/c1-9(25)28-13-10(6-27-19(4)30-17(26)18(2,3)31-19)29-16(11(13)20)24-8-23-12-14(24)21-7-22-15(12)32-5/h7-8,10-11,13,16H,6H2,1-5H3/t10-,11+,13-,16-,19?/m1/s1 |
| InChIKey | YYXNAJRRVQCLQP-NSUUWCHVSA-N |
| XLogP | 2.18 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|