C10H20F2N2 — CID 105265162
[1-(3,4-dimethylcyclohexyl)-2,2-difluoroethyl]hydrazine (PubChem CID 105265162) has the molecular formula C10H20F2N2 and a molecular weight of 206.28 g/mol. Its IUPAC name is [1-(3,4-dimethylcyclohexyl)-2,2-difluoroethyl]hydrazine.
| Compound Name | [1-(3,4-dimethylcyclohexyl)-2,2-difluoroethyl]hydrazine |
|---|---|
| PubChem CID | 105265162 |
| Molecular Formula | C10H20F2N2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.16 |
| IUPAC Name | [1-(3,4-dimethylcyclohexyl)-2,2-difluoroethyl]hydrazine |
| SMILES | CC1CCC(C(NN)C(F)F)CC1C |
| InChI | InChI=1S/C10H20F2N2/c1-6-3-4-8(5-7(6)2)9(14-13)10(11)12/h6-10,14H,3-5,13H2,1-2H3 |
| InChIKey | LYDBYNGHSYVULZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|