C26H30O7 — CID 10527705
methyl (2S)-2-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonyloxy)-3-methylbutanoyl]oxy-3-methylbutanoate (PubChem CID 10527705) has the molecular formula C26H30O7 and a molecular weight of 454.52 g/mol. Its IUPAC name is methyl (2S)-2-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonyloxy)-3-methylbutanoyl]oxy-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonyloxy)-3-methylbutanoyl]oxy-3-methylbutanoate |
|---|---|
| PubChem CID | 10527705 |
| Molecular Formula | C26H30O7 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | methyl (2S)-2-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonyloxy)-3-methylbutanoyl]oxy-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](OC(=O)[C@@H](OC(=O)OCC1c2ccccc2-c2ccccc21)C(C)C)C(C)C |
| InChI | InChI=1S/C26H30O7/c1-15(2)22(24(27)30-5)32-25(28)23(16(3)4)33-26(29)31-14-21-19-12-8-6-10-17(19)18-11-7-9-13-20(18)21/h6-13,15-16,21-23H,14H2,1-5H3/t22-,23-/m0/s1 |
| InChIKey | YAXNECKEQDCUSE-GOTSBHOMSA-N |
| XLogP | 4.72 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|