C32H38O3 — CID 10528362
(2,6-ditert-butyl-4-methoxyphenyl) (1S,2R)-2-phenyl-1,2,3,4-tetrahydronaphthalene-1-carboxylate (PubChem CID 10528362) has the molecular formula C32H38O3 and a molecular weight of 470.65 g/mol. Its IUPAC name is (2,6-ditert-butyl-4-methoxyphenyl) (1S,2R)-2-phenyl-1,2,3,4-tetrahydronaphthalene-1-carboxylate.
| Compound Name | (2,6-ditert-butyl-4-methoxyphenyl) (1S,2R)-2-phenyl-1,2,3,4-tetrahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 10528362 |
| Molecular Formula | C32H38O3 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | (2,6-ditert-butyl-4-methoxyphenyl) (1S,2R)-2-phenyl-1,2,3,4-tetrahydronaphthalene-1-carboxylate |
| SMILES | COc1cc(C(C)(C)C)c(OC(=O)[C@@H]2c3ccccc3CC[C@H]2c2ccccc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C32H38O3/c1-31(2,3)26-19-23(34-7)20-27(32(4,5)6)29(26)35-30(33)28-24-16-12-11-15-22(24)17-18-25(28)21-13-9-8-10-14-21/h8-16,19-20,25,28H,17-18H2,1-7H3/t25-,28+/m0/s1 |
| InChIKey | YKHZZVKZLOACRP-LBNVMWSVSA-N |
| XLogP | 7.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|