C26H34N6O3 — CID 10528662
tert-butyl N-[2-[10-[2-(diethylamino)ethylamino]-8-oxo-4,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-14-yl]ethyl]carbamate (PubChem CID 10528662) has the molecular formula C26H34N6O3 and a molecular weight of 478.60 g/mol. Its IUPAC name is tert-butyl N-[2-[10-[2-(diethylamino)ethylamino]-8-oxo-4,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-14-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[10-[2-(diethylamino)ethylamino]-8-oxo-4,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-14-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 10528662 |
| Molecular Formula | C26H34N6O3 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | tert-butyl N-[2-[10-[2-(diethylamino)ethylamino]-8-oxo-4,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-14-yl]ethyl]carbamate |
| SMILES | CCN(CC)CCNc1ccc2c3c(nn2CCNC(=O)OC(C)(C)C)-c2cnccc2C(=O)c13 |
| InChI | InChI=1S/C26H34N6O3/c1-6-31(7-2)14-12-28-19-8-9-20-22-21(19)24(33)17-10-11-27-16-18(17)23(22)30-32(20)15-13-29-25(34)35-26(3,4)5/h8-11,16,28H,6-7,12-15H2,1-5H3,(H,29,34) |
| InChIKey | ILBWQLNNAGHYPF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|