C12H23F3N2O2S — CID 105290974
[4-methylsulfonyl-1-[4-(trifluoromethyl)cyclohexyl]butyl]hydrazine (PubChem CID 105290974) has the molecular formula C12H23F3N2O2S and a molecular weight of 316.39 g/mol. Its IUPAC name is [4-methylsulfonyl-1-[4-(trifluoromethyl)cyclohexyl]butyl]hydrazine.
| Compound Name | [4-methylsulfonyl-1-[4-(trifluoromethyl)cyclohexyl]butyl]hydrazine |
|---|---|
| PubChem CID | 105290974 |
| Molecular Formula | C12H23F3N2O2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | [4-methylsulfonyl-1-[4-(trifluoromethyl)cyclohexyl]butyl]hydrazine |
| SMILES | CS(=O)(=O)CCCC(NN)C1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H23F3N2O2S/c1-20(18,19)8-2-3-11(17-16)9-4-6-10(7-5-9)12(13,14)15/h9-11,17H,2-8,16H2,1H3 |
| InChIKey | PBOJXVAIZYOFKH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|