C11H22F2N2O2S — CID 105290948
[1-(4,4-difluorocyclohexyl)-4-methylsulfonylbutyl]hydrazine (PubChem CID 105290948) has the molecular formula C11H22F2N2O2S and a molecular weight of 284.37 g/mol. Its IUPAC name is [1-(4,4-difluorocyclohexyl)-4-methylsulfonylbutyl]hydrazine.
| Compound Name | [1-(4,4-difluorocyclohexyl)-4-methylsulfonylbutyl]hydrazine |
|---|---|
| PubChem CID | 105290948 |
| Molecular Formula | C11H22F2N2O2S |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | [1-(4,4-difluorocyclohexyl)-4-methylsulfonylbutyl]hydrazine |
| SMILES | CS(=O)(=O)CCCC(NN)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C11H22F2N2O2S/c1-18(16,17)8-2-3-10(15-14)9-4-6-11(12,13)7-5-9/h9-10,15H,2-8,14H2,1H3 |
| InChIKey | ZQTPZXHGGKSLBI-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|