C25H20N2O6S2 — CID 10529639
[3-(4-methylphenyl)sulfonyl-9-oxo-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13),11-pentaen-12-yl] 4-methylbenzenesulfonate (PubChem CID 10529639) has the molecular formula C25H20N2O6S2 and a molecular weight of 508.58 g/mol. Its IUPAC name is [3-(4-methylphenyl)sulfonyl-9-oxo-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13),11-pentaen-12-yl] 4-methylbenzenesulfonate.
| Compound Name | [3-(4-methylphenyl)sulfonyl-9-oxo-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13),11-pentaen-12-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10529639 |
| Molecular Formula | C25H20N2O6S2 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.08 |
| IUPAC Name | [3-(4-methylphenyl)sulfonyl-9-oxo-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13),11-pentaen-12-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2=CNC(=O)c3cccc4c3c2cn4S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H20N2O6S2/c1-16-6-10-18(11-7-16)34(29,30)27-15-21-23(33-35(31,32)19-12-8-17(2)9-13-19)14-26-25(28)20-4-3-5-22(27)24(20)21/h3-15H,1-2H3,(H,26,28) |
| InChIKey | FTHPVLXYFDHZMM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 111.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|