C31H34F3NO2 — CID 10529679
7-[2-ethyl-5-phenylmethoxy-4-[3-(trifluoromethyl)phenyl]phenoxy]-2,2-dimethylheptanenitrile (PubChem CID 10529679) has the molecular formula C31H34F3NO2 and a molecular weight of 509.61 g/mol. Its IUPAC name is 7-[2-ethyl-5-phenylmethoxy-4-[3-(trifluoromethyl)phenyl]phenoxy]-2,2-dimethylheptanenitrile.
| Compound Name | 7-[2-ethyl-5-phenylmethoxy-4-[3-(trifluoromethyl)phenyl]phenoxy]-2,2-dimethylheptanenitrile |
|---|---|
| PubChem CID | 10529679 |
| Molecular Formula | C31H34F3NO2 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | 7-[2-ethyl-5-phenylmethoxy-4-[3-(trifluoromethyl)phenyl]phenoxy]-2,2-dimethylheptanenitrile |
| SMILES | CCc1cc(-c2cccc(C(F)(F)F)c2)c(OCc2ccccc2)cc1OCCCCCC(C)(C)C#N |
| InChI | InChI=1S/C31H34F3NO2/c1-4-24-19-27(25-14-11-15-26(18-25)31(32,33)34)29(37-21-23-12-7-5-8-13-23)20-28(24)36-17-10-6-9-16-30(2,3)22-35/h5,7-8,11-15,18-20H,4,6,9-10,16-17,21H2,1-3H3 |
| InChIKey | KCVVJEFDTTUYCK-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|