C16H20BrIN2O4 — CID 10529726
ethyl (3S)-3-[[2-[(2-bromoacetyl)-methylamino]-5-iodobenzoyl]amino]butanoate (PubChem CID 10529726) has the molecular formula C16H20BrIN2O4 and a molecular weight of 511.15 g/mol. Its IUPAC name is ethyl (3S)-3-[[2-[(2-bromoacetyl)-methylamino]-5-iodobenzoyl]amino]butanoate.
| Compound Name | ethyl (3S)-3-[[2-[(2-bromoacetyl)-methylamino]-5-iodobenzoyl]amino]butanoate |
|---|---|
| PubChem CID | 10529726 |
| Molecular Formula | C16H20BrIN2O4 |
| Molecular Weight | 511.15 g/mol |
| Exact Mass | 509.97 |
| IUPAC Name | ethyl (3S)-3-[[2-[(2-bromoacetyl)-methylamino]-5-iodobenzoyl]amino]butanoate |
| SMILES | CCOC(=O)C[C@H](C)NC(=O)c1cc(I)ccc1N(C)C(=O)CBr |
| InChI | InChI=1S/C16H20BrIN2O4/c1-4-24-15(22)7-10(2)19-16(23)12-8-11(18)5-6-13(12)20(3)14(21)9-17/h5-6,8,10H,4,7,9H2,1-3H3,(H,19,23)/t10-/m0/s1 |
| InChIKey | FKGJSFJYWOELFN-JTQLQIEISA-N |
| XLogP | 2.72 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.15 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|