C26H41F3O4SSi — CID 10530380
[(1S,6S,9R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-6,9-dimethyl-3-propan-2-yl-12-tetracyclo[7.5.0.02,6.02,14]tetradeca-3,12-dienyl] trifluoromethanesulfonate (PubChem CID 10530380) has the molecular formula C26H41F3O4SSi and a molecular weight of 534.76 g/mol. Its IUPAC name is [(1S,6S,9R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-6,9-dimethyl-3-propan-2-yl-12-tetracyclo[7.5.0.02,6.02,14]tetradeca-3,12-dienyl] trifluoromethanesulfonate.
| Compound Name | [(1S,6S,9R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-6,9-dimethyl-3-propan-2-yl-12-tetracyclo[7.5.0.02,6.02,14]tetradeca-3,12-dienyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10530380 |
| Molecular Formula | C26H41F3O4SSi |
| Molecular Weight | 534.76 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | [(1S,6S,9R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-6,9-dimethyl-3-propan-2-yl-12-tetracyclo[7.5.0.02,6.02,14]tetradeca-3,12-dienyl] trifluoromethanesulfonate |
| SMILES | CC(C)C1=CC[C@]2(C)CC[C@@]3(C)[C@H](O[Si](C)(C)C(C)(C)C)CC(OS(=O)(=O)C(F)(F)F)=CC4[C@H]3C142 |
| InChI | InChI=1S/C26H41F3O4SSi/c1-16(2)18-10-11-23(6)12-13-24(7)20(33-35(8,9)22(3,4)5)15-17(14-19-21(24)25(18,19)23)32-34(30,31)26(27,28)29/h10,14,16,19-21H,11-13,15H2,1-9H3/t19?,20-,21-,23-,24+,25?/m1/s1 |
| InChIKey | PCIYOIWUOVJPLG-BVOFQFPYSA-N |
| XLogP | 7.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.76 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|