C24H45F3O4SSi2 — CID 11071624
[(4aR,8R,8aR)-4a-(trimethylsilylmethyl)-8-tri(propan-2-yl)silyloxy-4,5,6,7,8,8a-hexahydro-3H-naphthalen-1-yl] trifluoromethanesulfonate (PubChem CID 11071624) has the molecular formula C24H45F3O4SSi2 and a molecular weight of 542.85 g/mol. Its IUPAC name is [(4aR,8R,8aR)-4a-(trimethylsilylmethyl)-8-tri(propan-2-yl)silyloxy-4,5,6,7,8,8a-hexahydro-3H-naphthalen-1-yl] trifluoromethanesulfonate.
| Compound Name | [(4aR,8R,8aR)-4a-(trimethylsilylmethyl)-8-tri(propan-2-yl)silyloxy-4,5,6,7,8,8a-hexahydro-3H-naphthalen-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11071624 |
| Molecular Formula | C24H45F3O4SSi2 |
| Molecular Weight | 542.85 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | [(4aR,8R,8aR)-4a-(trimethylsilylmethyl)-8-tri(propan-2-yl)silyloxy-4,5,6,7,8,8a-hexahydro-3H-naphthalen-1-yl] trifluoromethanesulfonate |
| SMILES | CC(C)[Si](O[C@@H]1CCC[C@@]2(C[Si](C)(C)C)CCC=C(OS(=O)(=O)C(F)(F)F)[C@@H]12)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H45F3O4SSi2/c1-17(2)34(18(3)4,19(5)6)31-21-13-11-15-23(16-33(7,8)9)14-10-12-20(22(21)23)30-32(28,29)24(25,26)27/h12,17-19,21-22H,10-11,13-16H2,1-9H3/t21-,22+,23-/m1/s1 |
| InChIKey | QOKGXIGKYCCVTH-XPWALMASSA-N |
| XLogP | 8.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.85 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|