C29H36N6O5 — CID 10530665
diethyl (2S)-2-[[4-[1-(2,4-diamino-5-methylpyrido[2,3-d]pyrimidin-6-yl)pent-4-en-2-yl]benzoyl]amino]pentanedioate (PubChem CID 10530665) has the molecular formula C29H36N6O5 and a molecular weight of 548.64 g/mol. Its IUPAC name is diethyl (2S)-2-[[4-[1-(2,4-diamino-5-methylpyrido[2,3-d]pyrimidin-6-yl)pent-4-en-2-yl]benzoyl]amino]pentanedioate.
| Compound Name | diethyl (2S)-2-[[4-[1-(2,4-diamino-5-methylpyrido[2,3-d]pyrimidin-6-yl)pent-4-en-2-yl]benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 10530665 |
| Molecular Formula | C29H36N6O5 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | diethyl (2S)-2-[[4-[1-(2,4-diamino-5-methylpyrido[2,3-d]pyrimidin-6-yl)pent-4-en-2-yl]benzoyl]amino]pentanedioate |
| SMILES | C=CCC(Cc1cnc2nc(N)nc(N)c2c1C)c1ccc(C(=O)N[C@@H](CCC(=O)OCC)C(=O)OCC)cc1 |
| InChI | InChI=1S/C29H36N6O5/c1-5-8-20(15-21-16-32-26-24(17(21)4)25(30)34-29(31)35-26)18-9-11-19(12-10-18)27(37)33-22(28(38)40-7-3)13-14-23(36)39-6-2/h5,9-12,16,20,22H,1,6-8,13-15H2,2-4H3,(H,33,37)(H4,30,31,32,34,35)/t20?,22-/m0/s1 |
| InChIKey | BTYRPLLTMLMYIQ-IAXKEJLGSA-N |
| XLogP | 3.40 |
| TPSA | 172.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|