C12H21F3N2 — CID 105319636
[3-methyl-1-[4-(trifluoromethyl)cyclohexyl]but-3-enyl]hydrazine (PubChem CID 105319636) has the molecular formula C12H21F3N2 and a molecular weight of 250.31 g/mol. Its IUPAC name is [3-methyl-1-[4-(trifluoromethyl)cyclohexyl]but-3-enyl]hydrazine.
| Compound Name | [3-methyl-1-[4-(trifluoromethyl)cyclohexyl]but-3-enyl]hydrazine |
|---|---|
| PubChem CID | 105319636 |
| Molecular Formula | C12H21F3N2 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | [3-methyl-1-[4-(trifluoromethyl)cyclohexyl]but-3-enyl]hydrazine |
| SMILES | C=C(C)CC(NN)C1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H21F3N2/c1-8(2)7-11(17-16)9-3-5-10(6-4-9)12(13,14)15/h9-11,17H,1,3-7,16H2,2H3 |
| InChIKey | ZBTCEOUVXACWFG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|