C30H66O3Si2Sn — CID 10532271
tert-butyl-dimethyl-[(E,6R)-6-tributylstannyl-6-(2-trimethylsilylethoxymethoxy)hex-4-enoxy]silane (PubChem CID 10532271) has the molecular formula C30H66O3Si2Sn and a molecular weight of 649.74 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E,6R)-6-tributylstannyl-6-(2-trimethylsilylethoxymethoxy)hex-4-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(E,6R)-6-tributylstannyl-6-(2-trimethylsilylethoxymethoxy)hex-4-enoxy]silane |
|---|---|
| PubChem CID | 10532271 |
| Molecular Formula | C30H66O3Si2Sn |
| Molecular Weight | 649.74 g/mol |
| Exact Mass | 650.36 |
| IUPAC Name | tert-butyl-dimethyl-[(E,6R)-6-tributylstannyl-6-(2-trimethylsilylethoxymethoxy)hex-4-enoxy]silane |
| SMILES | CCCC[Sn](CCCC)(CCCC)[C@H](/C=C/CCCO[Si](C)(C)C(C)(C)C)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C18H39O3Si2.3C4H9.Sn/c1-18(2,3)23(7,8)21-14-12-10-9-11-13-19-17-20-15-16-22(4,5)6;3*1-3-4-2;/h9,11,13H,10,12,14-17H2,1-8H3;3*1,3-4H2,2H3;/b11-9+;;;; |
| InChIKey | DJXZULOFNRXMKT-ARLMWRGNSA-N |
| XLogP | 10.43 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.74 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|