C23H50O2SiSn — CID 10720321
trimethyl-[2-[[(E,2S)-5-tributylstannylpent-3-en-2-yl]oxymethoxy]ethyl]silane (PubChem CID 10720321) has the molecular formula C23H50O2SiSn and a molecular weight of 505.45 g/mol. Its IUPAC name is trimethyl-[2-[[(E,2S)-5-tributylstannylpent-3-en-2-yl]oxymethoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[(E,2S)-5-tributylstannylpent-3-en-2-yl]oxymethoxy]ethyl]silane |
|---|---|
| PubChem CID | 10720321 |
| Molecular Formula | C23H50O2SiSn |
| Molecular Weight | 505.45 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | trimethyl-[2-[[(E,2S)-5-tributylstannylpent-3-en-2-yl]oxymethoxy]ethyl]silane |
| SMILES | CCCC[Sn](C/C=C/[C@H](C)OCOCC[Si](C)(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C11H23O2Si.3C4H9.Sn/c1-6-7-11(2)13-10-12-8-9-14(3,4)5;3*1-3-4-2;/h6-7,11H,1,8-10H2,2-5H3;3*1,3-4H2,2H3;/b7-6+;;;;/t11-;;;;/m0..../s1 |
| InChIKey | PTLAYJMZLWUULN-PSOIKBBJSA-N |
| XLogP | 8.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.45 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|