C14H28N2OS — CID 105341728
[(2-methylthiolan-2-yl)-(2,2,5,5-tetramethyloxolan-3-yl)methyl]hydrazine (PubChem CID 105341728) has the molecular formula C14H28N2OS and a molecular weight of 272.46 g/mol. Its IUPAC name is [(2-methylthiolan-2-yl)-(2,2,5,5-tetramethyloxolan-3-yl)methyl]hydrazine.
| Compound Name | [(2-methylthiolan-2-yl)-(2,2,5,5-tetramethyloxolan-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105341728 |
| Molecular Formula | C14H28N2OS |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | [(2-methylthiolan-2-yl)-(2,2,5,5-tetramethyloxolan-3-yl)methyl]hydrazine |
| SMILES | CC1(C)CC(C(NN)C2(C)CCCS2)C(C)(C)O1 |
| InChI | InChI=1S/C14H28N2OS/c1-12(2)9-10(13(3,4)17-12)11(16-15)14(5)7-6-8-18-14/h10-11,16H,6-9,15H2,1-5H3 |
| InChIKey | JXTZSLNRJGMNNL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|