C12H11Cl3O — CID 105349113
2-cyclopropyl-1-(2,4,6-trichlorophenyl)propan-1-one (PubChem CID 105349113) has the molecular formula C12H11Cl3O and a molecular weight of 277.58 g/mol. Its IUPAC name is 2-cyclopropyl-1-(2,4,6-trichlorophenyl)propan-1-one.
| Compound Name | 2-cyclopropyl-1-(2,4,6-trichlorophenyl)propan-1-one |
|---|---|
| PubChem CID | 105349113 |
| Molecular Formula | C12H11Cl3O |
| Molecular Weight | 277.58 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | 2-cyclopropyl-1-(2,4,6-trichlorophenyl)propan-1-one |
| SMILES | CC(C(=O)c1c(Cl)cc(Cl)cc1Cl)C1CC1 |
| InChI | InChI=1S/C12H11Cl3O/c1-6(7-2-3-7)12(16)11-9(14)4-8(13)5-10(11)15/h4-7H,2-3H2,1H3 |
| InChIKey | JCSJVAAIEBZOKX-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.58 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |