C12H13F3O3S — CID 105353071
2-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]butanoic acid (PubChem CID 105353071) has the molecular formula C12H13F3O3S and a molecular weight of 294.29 g/mol. Its IUPAC name is 2-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]butanoic acid.
| Compound Name | 2-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 105353071 |
| Molecular Formula | C12H13F3O3S |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 2-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]butanoic acid |
| SMILES | CCC(SCc1ccc(OC(F)(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C12H13F3O3S/c1-2-10(11(16)17)19-7-8-3-5-9(6-4-8)18-12(13,14)15/h3-6,10H,2,7H2,1H3,(H,16,17) |
| InChIKey | ILCKJUSRTBPFOY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |