C13H15BrO3S — CID 105356380
6-bromo-3-ethyl-5,8-dimethoxy-1H-isothiochromen-4-one (PubChem CID 105356380) has the molecular formula C13H15BrO3S and a molecular weight of 331.23 g/mol. Its IUPAC name is 6-bromo-3-ethyl-5,8-dimethoxy-1H-isothiochromen-4-one.
| Compound Name | 6-bromo-3-ethyl-5,8-dimethoxy-1H-isothiochromen-4-one |
|---|---|
| PubChem CID | 105356380 |
| Molecular Formula | C13H15BrO3S |
| Molecular Weight | 331.23 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | 6-bromo-3-ethyl-5,8-dimethoxy-1H-isothiochromen-4-one |
| SMILES | CCC1SCc2c(OC)cc(Br)c(OC)c2C1=O |
| InChI | InChI=1S/C13H15BrO3S/c1-4-10-12(15)11-7(6-18-10)9(16-2)5-8(14)13(11)17-3/h5,10H,4,6H2,1-3H3 |
| InChIKey | XKBZUISGAJLZRT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.23 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |