C7H5ClN2O2S — CID 105356964
7-chloro-4-oxo-1H-pyrido[2,3-b][1,4]thiazin-2-one (PubChem CID 105356964) has the molecular formula C7H5ClN2O2S and a molecular weight of 216.65 g/mol. Its IUPAC name is 7-chloro-4-oxo-1H-pyrido[2,3-b][1,4]thiazin-2-one.
| Compound Name | 7-chloro-4-oxo-1H-pyrido[2,3-b][1,4]thiazin-2-one |
|---|---|
| PubChem CID | 105356964 |
| Molecular Formula | C7H5ClN2O2S |
| Molecular Weight | 216.65 g/mol |
| Exact Mass | 215.98 |
| IUPAC Name | 7-chloro-4-oxo-1H-pyrido[2,3-b][1,4]thiazin-2-one |
| SMILES | O=C1CS(=O)c2ncc(Cl)cc2N1 |
| InChI | InChI=1S/C7H5ClN2O2S/c8-4-1-5-7(9-2-4)13(12)3-6(11)10-5/h1-2H,3H2,(H,10,11) |
| InChIKey | SXADGQJXRFJMLR-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.65 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |