C7H5ClN2O3S — CID 105356998
7-chloro-4,4-dioxo-1H-pyrido[2,3-b][1,4]thiazin-2-one (PubChem CID 105356998) has the molecular formula C7H5ClN2O3S and a molecular weight of 232.65 g/mol. Its IUPAC name is 7-chloro-4,4-dioxo-1H-pyrido[2,3-b][1,4]thiazin-2-one.
| Compound Name | 7-chloro-4,4-dioxo-1H-pyrido[2,3-b][1,4]thiazin-2-one |
|---|---|
| PubChem CID | 105356998 |
| Molecular Formula | C7H5ClN2O3S |
| Molecular Weight | 232.65 g/mol |
| Exact Mass | 231.97 |
| IUPAC Name | 7-chloro-4,4-dioxo-1H-pyrido[2,3-b][1,4]thiazin-2-one |
| SMILES | O=C1CS(=O)(=O)c2ncc(Cl)cc2N1 |
| InChI | InChI=1S/C7H5ClN2O3S/c8-4-1-5-7(9-2-4)14(12,13)3-6(11)10-5/h1-2H,3H2,(H,10,11) |
| InChIKey | ACXMKNYTHMDMAB-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.65 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |