C7H12ClN5O — CID 10536765
6-amino-3,9-dimethyl-2,7-dihydropurin-1-ium-8-one chloride (PubChem CID 10536765) has the molecular formula C7H12ClN5O and a molecular weight of 217.66 g/mol. Its IUPAC name is 6-amino-3,9-dimethyl-2,7-dihydropurin-1-ium-8-one chloride.
| Compound Name | 6-amino-3,9-dimethyl-2,7-dihydropurin-1-ium-8-one chloride |
|---|---|
| PubChem CID | 10536765 |
| Molecular Formula | C7H12ClN5O |
| Molecular Weight | 217.66 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 6-amino-3,9-dimethyl-2,7-dihydropurin-1-ium-8-one chloride |
| SMILES | CN1C[NH+]=C(N)c2[nH]c(=O)n(C)c21.[Cl-] |
| InChI | InChI=1S/C7H11N5O.ClH/c1-11-3-9-5(8)4-6(11)12(2)7(13)10-4;/h3H2,1-2H3,(H2,8,9)(H,10,13);1H |
| InChIKey | OCJOTUAITPNODW-UHFFFAOYSA-N |
| XLogP | -6.09 |
| TPSA | 81.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.66 |
| LogP ≤ 5 | -6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |