6-amino-3,9-dimethyl-2,7-dihydropurin-1-ium-8-one chloride

C7H12ClN5O — CID 10536765

IUPAC6-amino-3,9-dimethyl-2,7-dihydropurin-1-ium-8-one chloride
SMILESCN1C[NH+]=C(N)c2[nH]c(=O)n(C)c21.[Cl-]
InChIInChI=1S/C7H11N5O.ClH/c1-11-3-9-5(8)4-6(11)12(2)7(13)10-4;/h3H2,1-2H3,(H2,8,9)(H,10,13);1H
InChIKeyOCJOTUAITPNODW-UHFFFAOYSA-N
MW217.66 g/mol
LogP-6.09
Rot. Bonds

About 6-amino-3,9-dimethyl-2,7-dihydropurin-1-ium-8-one chloride

6-amino-3,9-dimethyl-2,7-dihydropurin-1-ium-8-one chloride (PubChem CID 10536765) has the molecular formula C7H12ClN5O and a molecular weight of 217.66 g/mol. Its IUPAC name is 6-amino-3,9-dimethyl-2,7-dihydropurin-1-ium-8-one chloride.

Molecular Properties

Compound Name6-amino-3,9-dimethyl-2,7-dihydropurin-1-ium-8-one chloride
PubChem CID10536765
Molecular FormulaC7H12ClN5O
Molecular Weight217.66 g/mol
Exact Mass217.07
IUPAC Name6-amino-3,9-dimethyl-2,7-dihydropurin-1-ium-8-one chloride
SMILESCN1C[NH+]=C(N)c2[nH]c(=O)n(C)c21.[Cl-]
InChIInChI=1S/C7H11N5O.ClH/c1-11-3-9-5(8)4-6(11)12(2)7(13)10-4;/h3H2,1-2H3,(H2,8,9)(H,10,13);1H
InChIKeyOCJOTUAITPNODW-UHFFFAOYSA-N
XLogP-6.09
TPSA81.02 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500217.66
LogP ≤ 5-6.09
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 6-amino-3,9-dimethyl-2,7-dihydropurin-1-ium-8-one chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-amino-3,9-dimethyl-2,7-dihydropurin-1-ium-8-one chloride?
The IUPAC name of 6-amino-3,9-dimethyl-2,7-dihydropurin-1-ium-8-one chloride (CID 10536765) is 6-amino-3,9-dimethyl-2,7-dihydropurin-1-ium-8-one chloride.
What is the SMILES notation for 6-amino-3,9-dimethyl-2,7-dihydropurin-1-ium-8-one chloride?
The canonical SMILES for 6-amino-3,9-dimethyl-2,7-dihydropurin-1-ium-8-one chloride is CN1C[NH+]=C(N)c2[nH]c(=O)n(C)c21.[Cl-].
What is the InChIKey of 6-amino-3,9-dimethyl-2,7-dihydropurin-1-ium-8-one chloride?
The InChIKey is OCJOTUAITPNODW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N5O.ClH/c1-11-3-9-5(8)4-6(11)12(2)7(13)10-4;/h3H2,1-2H3,(H2,8,9)(H,10,13);1H.
What are the key properties of 6-amino-3,9-dimethyl-2,7-dihydropurin-1-ium-8-one chloride?
6-amino-3,9-dimethyl-2,7-dihydropurin-1-ium-8-one chloride has a molecular weight of 217.66 g/mol, XLogP of -6.09, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3,9-dimethyl-2,7-dihydropurin-1-ium-8-one chloride is sourced from PubChem (CID 10536765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).