C7H12N5O+ — CID 10536766
6-amino-3,9-dimethyl-2,7-dihydropurin-1-ium-8-one (PubChem CID 10536766) has the molecular formula C7H12N5O+ and a molecular weight of 182.21 g/mol. Its IUPAC name is 6-amino-3,9-dimethyl-2,7-dihydropurin-1-ium-8-one.
| Compound Name | 6-amino-3,9-dimethyl-2,7-dihydropurin-1-ium-8-one |
|---|---|
| PubChem CID | 10536766 |
| Molecular Formula | C7H12N5O+ |
| Molecular Weight | 182.21 g/mol |
| Exact Mass | 182.10 |
| IUPAC Name | 6-amino-3,9-dimethyl-2,7-dihydropurin-1-ium-8-one |
| SMILES | CN1C[NH+]=C(N)c2[nH]c(=O)n(C)c21 |
| InChI | InChI=1S/C7H11N5O/c1-11-3-9-5(8)4-6(11)12(2)7(13)10-4/h3H2,1-2H3,(H2,8,9)(H,10,13)/p+1 |
| InChIKey | OJKOIVFQMNTAGV-UHFFFAOYSA-O |
| XLogP | -3.09 |
| TPSA | 81.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.21 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |